C27H26NO2PtS- — CID 58939478
2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58939478) has the molecular formula C27H26NO2PtS- and a molecular weight of 623.66 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58939478 |
| Molecular Formula | C27H26NO2PtS- |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C)c(-c2cccnc2-c2[c-]c3ccccc3s2)c(C)c1.[Pt] |
| InChI | InChI=1S/C22H18NS.C5H8O2.Pt/c1-14-11-15(2)21(16(3)12-14)18-8-6-10-23-22(18)20-13-17-7-4-5-9-19(17)24-20;1-4(6)3-5(2)7;/h4-12H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | FUJSQTRJPLTMBD-LWFKIUJUSA-N |
| XLogP | 7.39 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|