C44H36N2PtS2 — CID 58939578
bis(2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine);platinum(2+) (PubChem CID 58939578) has the molecular formula C44H36N2PtS2 and a molecular weight of 852.00 g/mol. Its IUPAC name is bis(2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine);platinum(2+).
| Compound Name | bis(2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine);platinum(2+) |
|---|---|
| PubChem CID | 58939578 |
| Molecular Formula | C44H36N2PtS2 |
| Molecular Weight | 852.00 g/mol |
| Exact Mass | 851.20 |
| IUPAC Name | bis(2-(3H-1-benzothiophen-3-id-2-yl)-3-(2,4,6-trimethylphenyl)pyridine);platinum(2+) |
| SMILES | Cc1cc(C)c(-c2cccnc2-c2[c-]c3ccccc3s2)c(C)c1.Cc1cc(C)c(-c2cccnc2-c2[c-]c3ccccc3s2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/2C22H18NS.Pt/c2*1-14-11-15(2)21(16(3)12-14)18-8-6-10-23-22(18)20-13-17-7-4-5-9-19(17)24-20;/h2*4-12H,1-3H3;/q2*-1;+2 |
| InChIKey | PTQNDNQOJIJOBW-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.00 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|