C21H28N2O2 — CID 58939704
4,8-diethyl-5,7-dimethyl-18-oxa-4,8-diazatetracyclo[9.7.0.03,9.012,16]octadeca-1,3(9),10,12(16)-tetraen-17-one (PubChem CID 58939704) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4,8-diethyl-5,7-dimethyl-18-oxa-4,8-diazatetracyclo[9.7.0.03,9.012,16]octadeca-1,3(9),10,12(16)-tetraen-17-one.
| Compound Name | 4,8-diethyl-5,7-dimethyl-18-oxa-4,8-diazatetracyclo[9.7.0.03,9.012,16]octadeca-1,3(9),10,12(16)-tetraen-17-one |
|---|---|
| PubChem CID | 58939704 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4,8-diethyl-5,7-dimethyl-18-oxa-4,8-diazatetracyclo[9.7.0.03,9.012,16]octadeca-1,3(9),10,12(16)-tetraen-17-one |
| SMILES | CCN1c2cc3oc(=O)c4c(c3cc2N(CC)C(C)CC1C)CCC4 |
| InChI | InChI=1S/C21H28N2O2/c1-5-22-13(3)10-14(4)23(6-2)19-12-20-17(11-18(19)22)15-8-7-9-16(15)21(24)25-20/h11-14H,5-10H2,1-4H3 |
| InChIKey | TZBNWAZCXDDWCC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|