About 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one
6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one (PubChem CID 58939827) has the molecular formula C12H12O6
and a molecular weight of 252.22 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one |
| PubChem CID | 58939827 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one |
| SMILES | Cc1cc(C2=C(O)OC(C)(C)OC2=O)cc(=O)o1 |
| InChI | InChI=1S/C12H12O6/c1-6-4-7(5-8(13)16-6)9-10(14)17-12(2,3)18-11(9)15/h4-5,14H,1-3H3 |
| InChIKey | PIBJGJDPUFDAIO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one?
The IUPAC name of 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one (CID 58939827) is 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one.
What is the SMILES notation for 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one?
The canonical SMILES for 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one is Cc1cc(C2=C(O)OC(C)(C)OC2=O)cc(=O)o1.
What is the InChIKey of 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one?
The InChIKey is PIBJGJDPUFDAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O6/c1-6-4-7(5-8(13)16-6)9-10(14)17-12(2,3)18-11(9)15/h4-5,14H,1-3H3.
What are the key properties of 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one?
6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one has a molecular weight of 252.22 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,2-dimethyl-5-(2-methyl-6-oxopyran-4-yl)-1,3-dioxin-4-one is sourced from PubChem (CID 58939827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).