C21H38Cl3NO5Si — CID 58940131
[(3aR,6S,8R,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-diethyl-8-methyl-3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]oxepin-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 58940131) has the molecular formula C21H38Cl3NO5Si and a molecular weight of 518.98 g/mol. Its IUPAC name is [(3aR,6S,8R,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-diethyl-8-methyl-3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]oxepin-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,6S,8R,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-diethyl-8-methyl-3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]oxepin-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 58940131 |
| Molecular Formula | C21H38Cl3NO5Si |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | [(3aR,6S,8R,8aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-diethyl-8-methyl-3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]oxepin-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](C)[C@H]2OC(CC)(CC)O[C@@H]12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H38Cl3NO5Si/c1-9-20(10-2)29-15-13(3)11-14(12-26-31(7,8)19(4,5)6)27-17(16(15)30-20)28-18(25)21(22,23)24/h13-17,25H,9-12H2,1-8H3/b25-18+/t13-,14+,15-,16-,17?/m1/s1 |
| InChIKey | VFLQPBPIIYNPJU-MYYQVTKCSA-N |
| XLogP | 6.42 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|