About [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate
[3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 58940162) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate.
Molecular Properties
| Compound Name | [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate |
| PubChem CID | 58940162 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | COC1OC(CO)=CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C11H16O7/c1-6(13)16-9-4-8(5-12)18-11(15-3)10(9)17-7(2)14/h4,9-12H,5H2,1-3H3 |
| InChIKey | INXUNMLANJDJDY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate?
The IUPAC name of [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate (CID 58940162) is [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate.
What is the SMILES notation for [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate?
The canonical SMILES for [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate is COC1OC(CO)=CC(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate?
The InChIKey is INXUNMLANJDJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O7/c1-6(13)16-9-4-8(5-12)18-11(15-3)10(9)17-7(2)14/h4,9-12H,5H2,1-3H3.
What are the key properties of [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate?
[3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate has a molecular weight of 260.24 g/mol, XLogP of -0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-6-(hydroxymethyl)-2-methoxy-3,4-dihydro-2H-pyran-4-yl] acetate is sourced from PubChem (CID 58940162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).