C17H28O6 — CID 58940210
(3aR,6S,6aR)-6-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 58940210) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3aR,6S,6aR)-6-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-6-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 58940210 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3aR,6S,6aR)-6-[(2,2-diethyl-1,3-dioxolan-4-yl)methyl]-2,2-diethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCC1(CC)OCC(C[C@@H]2OC(=O)[C@@H]3OC(CC)(CC)O[C@H]23)O1 |
| InChI | InChI=1S/C17H28O6/c1-5-16(6-2)19-10-11(21-16)9-12-13-14(15(18)20-12)23-17(7-3,8-4)22-13/h11-14H,5-10H2,1-4H3/t11?,12-,13+,14+/m0/s1 |
| InChIKey | ZKKIBROHJBVVFO-CKISJDIXSA-N |
| XLogP | 2.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |