C18H32O5 — CID 58940243
5-[1-(2,2-diethyl-1,3-dioxolan-4-yl)propan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 58940243) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is 5-[1-(2,2-diethyl-1,3-dioxolan-4-yl)propan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | 5-[1-(2,2-diethyl-1,3-dioxolan-4-yl)propan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 58940243 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 5-[1-(2,2-diethyl-1,3-dioxolan-4-yl)propan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCC1(CC)OCC(CC(C)C2OC(CC)(CC)OC2C=O)O1 |
| InChI | InChI=1S/C18H32O5/c1-6-17(7-2)20-12-14(21-17)10-13(5)16-15(11-19)22-18(8-3,9-4)23-16/h11,13-16H,6-10,12H2,1-5H3 |
| InChIKey | YKLVSKUFBZDVOE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|