C19H32O6 — CID 58940308
[5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 58940308) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is [5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 58940308 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CCC1(CC)OCC(C=CC2OC(CC)(CC)OC2COC(C)=O)O1 |
| InChI | InChI=1S/C19H32O6/c1-6-18(7-2)22-12-15(23-18)10-11-16-17(13-21-14(5)20)25-19(8-3,9-4)24-16/h10-11,15-17H,6-9,12-13H2,1-5H3 |
| InChIKey | CQMXPVIDGVYNLP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|