C14H22O7 — CID 58940328
[(2S,5R,6S,7S)-5,6-diacetyloxy-7-methyloxepan-2-yl]methyl acetate (PubChem CID 58940328) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is [(2S,5R,6S,7S)-5,6-diacetyloxy-7-methyloxepan-2-yl]methyl acetate.
| Compound Name | [(2S,5R,6S,7S)-5,6-diacetyloxy-7-methyloxepan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58940328 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(2S,5R,6S,7S)-5,6-diacetyloxy-7-methyloxepan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](C)O1 |
| InChI | InChI=1S/C14H22O7/c1-8-14(21-11(4)17)13(20-10(3)16)6-5-12(19-8)7-18-9(2)15/h8,12-14H,5-7H2,1-4H3/t8-,12-,13+,14-/m0/s1 |
| InChIKey | NWNFJNDRVHLNLX-IOEYQFCTSA-N |
| XLogP | 0.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|