C16H26O7 — CID 58940381
[(2S,3S,4S,5R,6S,7S)-5,6-diacetyloxy-3,4,7-trimethyloxepan-2-yl]methyl acetate (PubChem CID 58940381) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S,7S)-5,6-diacetyloxy-3,4,7-trimethyloxepan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S,7S)-5,6-diacetyloxy-3,4,7-trimethyloxepan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58940381 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(2S,3S,4S,5R,6S,7S)-5,6-diacetyloxy-3,4,7-trimethyloxepan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C16H26O7/c1-8-9(2)15(22-12(5)18)16(23-13(6)19)10(3)21-14(8)7-20-11(4)17/h8-10,14-16H,7H2,1-6H3/t8-,9-,10-,14+,15+,16-/m0/s1 |
| InChIKey | FFFXDDVMXLGQCE-KLRNGOMUSA-N |
| XLogP | 1.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|