C17H30O5 — CID 58940394
5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 58940394) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | 5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 58940394 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 5-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCC1(CC)OCC(CCC2OC(CC)(CC)OC2C=O)O1 |
| InChI | InChI=1S/C17H30O5/c1-5-16(6-2)19-12-13(20-16)9-10-14-15(11-18)22-17(7-3,8-4)21-14/h11,13-15H,5-10,12H2,1-4H3 |
| InChIKey | RASNLCLWXDTXDB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|