C13H22O5 — CID 58940443
(4S)-4-[(4R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol (PubChem CID 58940443) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (4S)-4-[(4R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol.
| Compound Name | (4S)-4-[(4R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 58940443 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (4S)-4-[(4R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol |
| SMILES | C=CC1OC(C)(C)O[C@H]1[C@H]1OC(C)(C)OCC1O |
| InChI | InChI=1S/C13H22O5/c1-6-9-11(18-13(4,5)16-9)10-8(14)7-15-12(2,3)17-10/h6,8-11,14H,1,7H2,2-5H3/t8?,9?,10-,11+/m0/s1 |
| InChIKey | JRSIHLDQBCWQQE-WFBLGPOFSA-N |
| XLogP | 1.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|