C19H34O5 — CID 58940474
5-[3-(2,2-diethyl-1,3-dioxolan-4-yl)butan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 58940474) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is 5-[3-(2,2-diethyl-1,3-dioxolan-4-yl)butan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | 5-[3-(2,2-diethyl-1,3-dioxolan-4-yl)butan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 58940474 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 5-[3-(2,2-diethyl-1,3-dioxolan-4-yl)butan-2-yl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCC1(CC)OCC(C(C)C(C)C2OC(CC)(CC)OC2C=O)O1 |
| InChI | InChI=1S/C19H34O5/c1-7-18(8-2)21-12-16(23-18)13(5)14(6)17-15(11-20)22-19(9-3,10-4)24-17/h11,13-17H,7-10,12H2,1-6H3 |
| InChIKey | VJHLOYFFUDEKKC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|