C16H30O5Si — CID 58940513
(3aR,7R,8aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-4-one (PubChem CID 58940513) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (3aR,7R,8aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-4-one.
| Compound Name | (3aR,7R,8aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-4-one |
|---|---|
| PubChem CID | 58940513 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3aR,7R,8aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-4-one |
| SMILES | CC1(C)O[C@@H]2C[C@@H](CO[Si](C)(C)C(C)(C)C)COC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C16H30O5Si/c1-15(2,3)22(6,7)19-10-11-8-12-13(14(17)18-9-11)21-16(4,5)20-12/h11-13H,8-10H2,1-7H3/t11-,12-,13-/m1/s1 |
| InChIKey | GTJRNVKRBYHSIH-JHJVBQTASA-N |
| XLogP | 3.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|