C22H26N2O — CID 58940727
3-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-methylbenzamide (PubChem CID 58940727) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-methylbenzamide.
| Compound Name | 3-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 58940727 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc3c(c2)CCN(C2CCC2)CC3)c1 |
| InChI | InChI=1S/C22H26N2O/c1-23-22(25)20-5-2-4-17(15-20)18-9-8-16-10-12-24(21-6-3-7-21)13-11-19(16)14-18/h2,4-5,8-9,14-15,21H,3,6-7,10-13H2,1H3,(H,23,25) |
| InChIKey | ZZNOCYUGWSBJCB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |