C11H13FN2 — CID 58941055
8-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 58941055) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 8-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | 8-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 58941055 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 8-fluoro-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | Fc1ccc2c(c1)CC1CNCCN21 |
| InChI | InChI=1S/C11H13FN2/c12-9-1-2-11-8(5-9)6-10-7-13-3-4-14(10)11/h1-2,5,10,13H,3-4,6-7H2 |
| InChIKey | FPFIPQUHSRUKIA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |