About [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate
[5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 58941537) has the molecular formula C21H16F3N3O3S
and a molecular weight of 447.44 g/mol. Its IUPAC name is [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate |
| PubChem CID | 58941537 |
| Molecular Formula | C21H16F3N3O3S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1c2cc(-c3cc(OS(=O)(=O)C(F)(F)F)cnc3-c3ccccc3)ccc2nn1C |
| InChI | InChI=1S/C21H16F3N3O3S/c1-13-17-10-15(8-9-19(17)26-27(13)2)18-11-16(30-31(28,29)21(22,23)24)12-25-20(18)14-6-4-3-5-7-14/h3-12H,1-2H3 |
| InChIKey | XDFQZNHHXOZBCA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate?
The IUPAC name of [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate (CID 58941537) is [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate.
What is the SMILES notation for [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate?
The canonical SMILES for [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate is Cc1c2cc(-c3cc(OS(=O)(=O)C(F)(F)F)cnc3-c3ccccc3)ccc2nn1C.
What is the InChIKey of [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate?
The InChIKey is XDFQZNHHXOZBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O3S/c1-13-17-10-15(8-9-19(17)26-27(13)2)18-11-16(30-31(28,29)21(22,23)24)12-25-20(18)14-6-4-3-5-7-14/h3-12H,1-2H3.
What are the key properties of [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate?
[5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate has a molecular weight of 447.44 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,3-dimethylindazol-5-yl)-6-phenyl-3-pyridinyl] trifluoromethanesulfonate is sourced from PubChem (CID 58941537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).