C11H5ClFN7O3 — CID 58941816
3-[4-(azidomethyl)-1,2,5-oxadiazol-3-yl]-4-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-one (PubChem CID 58941816) has the molecular formula C11H5ClFN7O3 and a molecular weight of 337.66 g/mol. Its IUPAC name is 3-[4-(azidomethyl)-1,2,5-oxadiazol-3-yl]-4-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-(azidomethyl)-1,2,5-oxadiazol-3-yl]-4-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 58941816 |
| Molecular Formula | C11H5ClFN7O3 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-[4-(azidomethyl)-1,2,5-oxadiazol-3-yl]-4-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazol-5-one |
| SMILES | [N-]=[N+]=NCc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H5ClFN7O3/c12-6-3-5(1-2-7(6)13)20-10(18-22-11(20)21)9-8(4-15-19-14)16-23-17-9/h1-3H,4H2 |
| InChIKey | FOCUBTLJSIZXHQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 135.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|