C15H26O4Si — CID 58942081
(1R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-6-oxabicyclo[3.2.1]oct-2-en-7-one (PubChem CID 58942081) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is (1R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-6-oxabicyclo[3.2.1]oct-2-en-7-one.
| Compound Name | (1R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-6-oxabicyclo[3.2.1]oct-2-en-7-one |
|---|---|
| PubChem CID | 58942081 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1R,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-6-oxabicyclo[3.2.1]oct-2-en-7-one |
| SMILES | CCO[C@@H]1C=C[C@]2(O[Si](C)(C)C(C)(C)C)C[C@@H]1OC2=O |
| InChI | InChI=1S/C15H26O4Si/c1-7-17-11-8-9-15(10-12(11)18-13(15)16)19-20(5,6)14(2,3)4/h8-9,11-12H,7,10H2,1-6H3/t11-,12+,15+/m1/s1 |
| InChIKey | CJCVGNGNOMXGBU-XUJVJEKNSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|