C20H22N2O2 — CID 589425
3,6-bis(2,4,6-trimethylphenyl)-1,4,2,5-dioxadiazine (PubChem CID 589425) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3,6-bis(2,4,6-trimethylphenyl)-1,4,2,5-dioxadiazine.
| Compound Name | 3,6-bis(2,4,6-trimethylphenyl)-1,4,2,5-dioxadiazine |
|---|---|
| PubChem CID | 589425 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3,6-bis(2,4,6-trimethylphenyl)-1,4,2,5-dioxadiazine |
| SMILES | Cc1cc(C)c(C2=NOC(c3c(C)cc(C)cc3C)=NO2)c(C)c1 |
| InChI | InChI=1S/C20H22N2O2/c1-11-7-13(3)17(14(4)8-11)19-21-24-20(22-23-19)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | RFFVDPBUUGDTFG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |