About 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate
5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate (PubChem CID 58942713) has the molecular formula C26H29NO5
and a molecular weight of 435.52 g/mol. Its IUPAC name is 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate.
Molecular Properties
| Compound Name | 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate |
| PubChem CID | 58942713 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc2c3c(cccc13)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C26H29NO5/c1-2-23(28)32-17-8-4-7-16-31-22-15-14-21-24-19(22)12-9-13-20(24)25(29)27(26(21)30)18-10-5-3-6-11-18/h2,9,12-15,18H,1,3-8,10-11,16-17H2 |
| InChIKey | AMKKQJYONSOWSB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate?
The IUPAC name of 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate (CID 58942713) is 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate.
What is the SMILES notation for 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate?
The canonical SMILES for 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate is C=CC(=O)OCCCCCOc1ccc2c3c(cccc13)C(=O)N(C1CCCCC1)C2=O.
What is the InChIKey of 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate?
The InChIKey is AMKKQJYONSOWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO5/c1-2-23(28)32-17-8-4-7-16-31-22-15-14-21-24-19(22)12-9-13-20(24)25(29)27(26(21)30)18-10-5-3-6-11-18/h2,9,12-15,18H,1,3-8,10-11,16-17H2.
What are the key properties of 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate?
5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate has a molecular weight of 435.52 g/mol, XLogP of 5.05, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclohexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate is sourced from PubChem (CID 58942713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).