About [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate
[4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate (PubChem CID 58943091) has the molecular formula C39H34O4
and a molecular weight of 566.70 g/mol. Its IUPAC name is [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate.
Molecular Properties
| Compound Name | [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate |
| PubChem CID | 58943091 |
| Molecular Formula | C39H34O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate |
| SMILES | COc1c(C)cc(C2(c3cc(C)c(OC(=O)c4ccc(C(C)=O)cc4)c(C)c3)c3ccccc3-c3ccccc32)cc1C |
| InChI | InChI=1S/C39H34O4/c1-23-19-30(20-24(2)36(23)42-6)39(34-13-9-7-11-32(34)33-12-8-10-14-35(33)39)31-21-25(3)37(26(4)22-31)43-38(41)29-17-15-28(16-18-29)27(5)40/h7-22H,1-6H3 |
| InChIKey | MCNHVNFASRYYOY-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate?
The IUPAC name of [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate (CID 58943091) is [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate.
What is the SMILES notation for [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate?
The canonical SMILES for [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate is COc1c(C)cc(C2(c3cc(C)c(OC(=O)c4ccc(C(C)=O)cc4)c(C)c3)c3ccccc3-c3ccccc32)cc1C.
What is the InChIKey of [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate?
The InChIKey is MCNHVNFASRYYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H34O4/c1-23-19-30(20-24(2)36(23)42-6)39(34-13-9-7-11-32(34)33-12-8-10-14-35(33)39)31-21-25(3)37(26(4)22-31)43-38(41)29-17-15-28(16-18-29)27(5)40/h7-22H,1-6H3.
What are the key properties of [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate?
[4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate has a molecular weight of 566.70 g/mol, XLogP of 8.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[9-(4-methoxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenyl] 4-acetylbenzoate is sourced from PubChem (CID 58943091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).