About 4-(3-bromophenyl)-2,6-diphenylpyrimidine
4-(3-bromophenyl)-2,6-diphenylpyrimidine (PubChem CID 58943285) has the molecular formula C22H15BrN2
and a molecular weight of 387.28 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2,6-diphenylpyrimidine.
Molecular Properties
| Compound Name | 4-(3-bromophenyl)-2,6-diphenylpyrimidine |
| PubChem CID | 58943285 |
| Molecular Formula | C22H15BrN2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 4-(3-bromophenyl)-2,6-diphenylpyrimidine |
| SMILES | Brc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H15BrN2/c23-19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)24-22(25-21)17-10-5-2-6-11-17/h1-15H |
| InChIKey | BPMSGKUGXMWVBH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-bromophenyl)-2,6-diphenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromophenyl)-2,6-diphenylpyrimidine?
The IUPAC name of 4-(3-bromophenyl)-2,6-diphenylpyrimidine (CID 58943285) is 4-(3-bromophenyl)-2,6-diphenylpyrimidine.
What is the SMILES notation for 4-(3-bromophenyl)-2,6-diphenylpyrimidine?
The canonical SMILES for 4-(3-bromophenyl)-2,6-diphenylpyrimidine is Brc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1.
What is the InChIKey of 4-(3-bromophenyl)-2,6-diphenylpyrimidine?
The InChIKey is BPMSGKUGXMWVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrN2/c23-19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)24-22(25-21)17-10-5-2-6-11-17/h1-15H.
What are the key properties of 4-(3-bromophenyl)-2,6-diphenylpyrimidine?
4-(3-bromophenyl)-2,6-diphenylpyrimidine has a molecular weight of 387.28 g/mol, XLogP of 6.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromophenyl)-2,6-diphenylpyrimidine is sourced from PubChem (CID 58943285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).