C67H49N5 — CID 58943596
2-[7-[3-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58943596) has the molecular formula C67H49N5 and a molecular weight of 924.16 g/mol. Its IUPAC name is 2-[7-[3-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-[3-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58943596 |
| Molecular Formula | C67H49N5 |
| Molecular Weight | 924.16 g/mol |
| Exact Mass | 923.40 |
| IUPAC Name | 2-[7-[3-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3cccc(-c4ccc5c(c4)C(C)(C)c4cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc4-5)c3)ccc2-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C67H49N5/c1-66(2)56-37-48(28-32-52(56)54-34-30-50(39-58(54)66)61-41-60(42-18-9-5-10-19-42)68-62(69-61)43-20-11-6-12-21-43)46-26-17-27-47(36-46)49-29-33-53-55-35-31-51(40-59(55)67(3,4)57(53)38-49)65-71-63(44-22-13-7-14-23-44)70-64(72-65)45-24-15-8-16-25-45/h5-41H,1-4H3 |
| InChIKey | HFEJKVWPOFERMV-UHFFFAOYSA-N |
| XLogP | 16.61 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.16 |
| LogP ≤ 5 | 16.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |