C17H30 — CID 58944199
1,2,2,3,4,5,5,6,7,7-decamethylbicyclo[4.1.0]hept-3-ene (PubChem CID 58944199) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1,2,2,3,4,5,5,6,7,7-decamethylbicyclo[4.1.0]hept-3-ene.
| Compound Name | 1,2,2,3,4,5,5,6,7,7-decamethylbicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 58944199 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1,2,2,3,4,5,5,6,7,7-decamethylbicyclo[4.1.0]hept-3-ene |
| SMILES | CC1=C(C)C(C)(C)C2(C)C(C)(C)C2(C)C1(C)C |
| InChI | InChI=1S/C17H30/c1-11-12(2)14(5,6)17(10)15(7,8)16(17,9)13(11,3)4/h1-10H3 |
| InChIKey | AVERPJCURNAXAC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|