About 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate
1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate (PubChem CID 58944344) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate |
| PubChem CID | 58944344 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate |
| SMILES | CC(OC(=O)C(C)O)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H24O4/c1-8(16)15(17)19-9(2)18-14-7-10-6-13(14)12-5-3-4-11(10)12/h8-14,16H,3-7H2,1-2H3 |
| InChIKey | WAEGMOUCFFBTLZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate?
The IUPAC name of 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate (CID 58944344) is 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate.
What is the SMILES notation for 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate?
The canonical SMILES for 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate is CC(OC(=O)C(C)O)OC1CC2CC1C1CCCC21.
What is the InChIKey of 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate?
The InChIKey is WAEGMOUCFFBTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-8(16)15(17)19-9(2)18-14-7-10-6-13(14)12-5-3-4-11(10)12/h8-14,16H,3-7H2,1-2H3.
What are the key properties of 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate?
1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate has a molecular weight of 268.35 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-tricyclo[5.2.1.02,6]decanyloxy)ethyl 2-hydroxypropanoate is sourced from PubChem (CID 58944344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).