About 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate
1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate (PubChem CID 58944362) has the molecular formula C25H40O12
and a molecular weight of 532.58 g/mol. Its IUPAC name is 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate |
| PubChem CID | 58944362 |
| Molecular Formula | C25H40O12 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate |
| SMILES | CC(OC(=O)C(C)O)OC1CC2CC1C1CC(OC(C)OC(=O)C(C)O)C(OC(C)OC(=O)C(C)O)C21 |
| InChI | InChI=1S/C25H40O12/c1-10(26)23(29)35-13(4)32-19-8-16-7-17(19)18-9-20(33-14(5)36-24(30)11(2)27)22(21(16)18)34-15(6)37-25(31)12(3)28/h10-22,26-28H,7-9H2,1-6H3 |
| InChIKey | SZPONDKEFHNTSI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate?
The IUPAC name of 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate (CID 58944362) is 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate.
What is the SMILES notation for 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate?
The canonical SMILES for 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate is CC(OC(=O)C(C)O)OC1CC2CC1C1CC(OC(C)OC(=O)C(C)O)C(OC(C)OC(=O)C(C)O)C21.
What is the InChIKey of 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate?
The InChIKey is SZPONDKEFHNTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O12/c1-10(26)23(29)35-13(4)32-19-8-16-7-17(19)18-9-20(33-14(5)36-24(30)11(2)27)22(21(16)18)34-15(6)37-25(31)12(3)28/h10-22,26-28H,7-9H2,1-6H3.
What are the key properties of 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate?
1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate has a molecular weight of 532.58 g/mol, XLogP of 0.63, 12 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,4-bis[1-(2-hydroxypropanoyloxy)ethoxy]-8-tricyclo[5.2.1.02,6]decanyl]oxy]ethyl 2-hydroxypropanoate is sourced from PubChem (CID 58944362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).