C14H22NO4P — CID 58944445
6-(diethoxyphosphorylmethoxy)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 58944445) has the molecular formula C14H22NO4P and a molecular weight of 299.31 g/mol. Its IUPAC name is 6-(diethoxyphosphorylmethoxy)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-(diethoxyphosphorylmethoxy)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 58944445 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(diethoxyphosphorylmethoxy)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOP(=O)(COc1ccc2c(c1)CCNC2)OCC |
| InChI | InChI=1S/C14H22NO4P/c1-3-18-20(16,19-4-2)11-17-14-6-5-13-10-15-8-7-12(13)9-14/h5-6,9,15H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | RZMUAQHENBJDBI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|