C9H14F5N — CID 58944774
1-methyl-3-(3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidine (PubChem CID 58944774) has the molecular formula C9H14F5N and a molecular weight of 231.21 g/mol. Its IUPAC name is 1-methyl-3-(3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidine.
| Compound Name | 1-methyl-3-(3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 58944774 |
| Molecular Formula | C9H14F5N |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-methyl-3-(3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidine |
| SMILES | CC(C1CCN(C)C1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14F5N/c1-6(7-3-4-15(2)5-7)8(10,11)9(12,13)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | QLNUQRCMGIYWMC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|