C20H24FN5O3 — CID 58944854
1-cyclopropyl-6-fluoro-7-[3-[2-isocyanoethyl(methyl)amino]pyrrolidin-1-yl]-8-methoxyquinazoline-2,4-dione (PubChem CID 58944854) has the molecular formula C20H24FN5O3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[3-[2-isocyanoethyl(methyl)amino]pyrrolidin-1-yl]-8-methoxyquinazoline-2,4-dione.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[3-[2-isocyanoethyl(methyl)amino]pyrrolidin-1-yl]-8-methoxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 58944854 |
| Molecular Formula | C20H24FN5O3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[3-[2-isocyanoethyl(methyl)amino]pyrrolidin-1-yl]-8-methoxyquinazoline-2,4-dione |
| SMILES | [C-]#[N+]CCN(C)C1CCN(c2c(F)cc3c(=O)[nH]c(=O)n(C4CC4)c3c2OC)C1 |
| InChI | InChI=1S/C20H24FN5O3/c1-22-7-9-24(2)13-6-8-25(11-13)17-15(21)10-14-16(18(17)29-3)26(12-4-5-12)20(28)23-19(14)27/h10,12-13H,4-9,11H2,2-3H3,(H,23,27,28) |
| InChIKey | RDMDDLHAVDWKEC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|