C23H30N6O3 — CID 58945127
N-[2-[1-(1-cyclopropyl-8-methyl-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]-2-(2-isocyanoethylamino)ethyl]acetamide (PubChem CID 58945127) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[2-[1-(1-cyclopropyl-8-methyl-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]-2-(2-isocyanoethylamino)ethyl]acetamide.
| Compound Name | N-[2-[1-(1-cyclopropyl-8-methyl-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]-2-(2-isocyanoethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 58945127 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-[2-[1-(1-cyclopropyl-8-methyl-2,4-dioxoquinazolin-7-yl)pyrrolidin-3-yl]-2-(2-isocyanoethylamino)ethyl]acetamide |
| SMILES | [C-]#[N+]CCNC(CNC(C)=O)C1CCN(c2ccc3c(=O)[nH]c(=O)n(C4CC4)c3c2C)C1 |
| InChI | InChI=1S/C23H30N6O3/c1-14-20(7-6-18-21(14)29(17-4-5-17)23(32)27-22(18)31)28-11-8-16(13-28)19(12-26-15(2)30)25-10-9-24-3/h6-7,16-17,19,25H,4-5,8-13H2,1-2H3,(H,26,30)(H,27,31,32) |
| InChIKey | GHFUDXIOHWQLNI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|