About 1-methylpyrrole-2,4-dicarbonyl chloride
1-methylpyrrole-2,4-dicarbonyl chloride (PubChem CID 58945296) has the molecular formula C7H5Cl2NO2
and a molecular weight of 206.03 g/mol. Its IUPAC name is 1-methylpyrrole-2,4-dicarbonyl chloride.
Molecular Properties
| Compound Name | 1-methylpyrrole-2,4-dicarbonyl chloride |
| PubChem CID | 58945296 |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | 1-methylpyrrole-2,4-dicarbonyl chloride |
| SMILES | Cn1cc(C(=O)Cl)cc1C(=O)Cl |
| InChI | InChI=1S/C7H5Cl2NO2/c1-10-3-4(6(8)11)2-5(10)7(9)12/h2-3H,1H3 |
| InChIKey | GVGHQDHBYLBPFJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrole-2,4-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrole-2,4-dicarbonyl chloride?
The IUPAC name of 1-methylpyrrole-2,4-dicarbonyl chloride (CID 58945296) is 1-methylpyrrole-2,4-dicarbonyl chloride.
What is the SMILES notation for 1-methylpyrrole-2,4-dicarbonyl chloride?
The canonical SMILES for 1-methylpyrrole-2,4-dicarbonyl chloride is Cn1cc(C(=O)Cl)cc1C(=O)Cl.
What is the InChIKey of 1-methylpyrrole-2,4-dicarbonyl chloride?
The InChIKey is GVGHQDHBYLBPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO2/c1-10-3-4(6(8)11)2-5(10)7(9)12/h2-3H,1H3.
What are the key properties of 1-methylpyrrole-2,4-dicarbonyl chloride?
1-methylpyrrole-2,4-dicarbonyl chloride has a molecular weight of 206.03 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrole-2,4-dicarbonyl chloride is sourced from PubChem (CID 58945296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).