About (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate
(2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate (PubChem CID 58945546) has the molecular formula C16H22N4O4
and a molecular weight of 334.38 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate |
| PubChem CID | 58945546 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate |
| SMILES | CCc1nc2ccc(OCC/N=C/OOC(C)(C)C)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C16H22N4O4/c1-5-15-18-13-7-6-12(10-14(13)20(21)19-15)22-9-8-17-11-23-24-16(2,3)4/h6-7,10-11H,5,8-9H2,1-4H3/b17-11+ |
| InChIKey | RIRQQPGCVAINTI-GZTJUZNOSA-N |
| XLogP | 1.98 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate?
The IUPAC name of (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate (CID 58945546) is (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate.
What is the SMILES notation for (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate?
The canonical SMILES for (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate is CCc1nc2ccc(OCC/N=C/OOC(C)(C)C)cc2[n+]([O-])n1.
What is the InChIKey of (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate?
The InChIKey is RIRQQPGCVAINTI-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H22N4O4/c1-5-15-18-13-7-6-12(10-14(13)20(21)19-15)22-9-8-17-11-23-24-16(2,3)4/h6-7,10-11H,5,8-9H2,1-4H3/b17-11+.
What are the key properties of (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate?
(2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate has a molecular weight of 334.38 g/mol, XLogP of 1.98, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy N-[2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]ethyl]methanimidate is sourced from PubChem (CID 58945546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).