About 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine
4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine (PubChem CID 58945607) has the molecular formula C13H6ClF3N4
and a molecular weight of 310.67 g/mol. Its IUPAC name is 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine |
| PubChem CID | 58945607 |
| Molecular Formula | C13H6ClF3N4 |
| Molecular Weight | 310.67 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine |
| SMILES | FC(F)(F)c1cccnc1-c1cnc2c(Cl)cnnc2c1 |
| InChI | InChI=1S/C13H6ClF3N4/c14-9-6-20-21-10-4-7(5-19-12(9)10)11-8(13(15,16)17)2-1-3-18-11/h1-6H |
| InChIKey | UQAQESOLQJILCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine?
The IUPAC name of 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine (CID 58945607) is 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine.
What is the SMILES notation for 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine?
The canonical SMILES for 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine is FC(F)(F)c1cccnc1-c1cnc2c(Cl)cnnc2c1.
What is the InChIKey of 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine?
The InChIKey is UQAQESOLQJILCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClF3N4/c14-9-6-20-21-10-4-7(5-19-12(9)10)11-8(13(15,16)17)2-1-3-18-11/h1-6H.
What are the key properties of 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine?
4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine has a molecular weight of 310.67 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-[3-(trifluoromethyl)-2-pyridinyl]pyrido[3,2-c]pyridazine is sourced from PubChem (CID 58945607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).