C23H27N3O4 — CID 58945810
N-cyclohexyl-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide (PubChem CID 58945810) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-cyclohexyl-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 58945810 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-cyclohexyl-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C(C(=O)NC3CCCCC3)C(O)c3cccnc32)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-30-17-11-9-15(10-12-17)14-26-21-18(8-5-13-24-21)20(27)19(23(26)29)22(28)25-16-6-3-2-4-7-16/h5,8-13,16,19-20,27H,2-4,6-7,14H2,1H3,(H,25,28) |
| InChIKey | AQQXVEXYJHGCFQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|