C37H41F3N6O6S — CID 58945894
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonamide (PubChem CID 58945894) has the molecular formula C37H41F3N6O6S and a molecular weight of 754.83 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 58945894 |
| Molecular Formula | C37H41F3N6O6S |
| Molecular Weight | 754.83 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2cn(C)nc2C(F)(F)F)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H41F3N6O6S/c1-24(25-10-6-5-7-11-25)44-18-20-45(21-19-44)29-13-8-12-27-33(29)36(48)46(35(27)47)28(26-15-16-30(51-3)31(22-26)52-4)14-9-17-41-53(49,50)32-23-43(2)42-34(32)37(38,39)40/h5-8,10-13,15-16,22-24,28,41H,9,14,17-21H2,1-4H3/t24-,28-/m1/s1 |
| InChIKey | KCLGKIGUCCIFHD-UFHPHHKVSA-N |
| XLogP | 5.44 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.83 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|