C37H44N6O6S — CID 58945897
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethylpyrazole-4-sulfonamide (PubChem CID 58945897) has the molecular formula C37H44N6O6S and a molecular weight of 700.86 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethylpyrazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 58945897 |
| Molecular Formula | C37H44N6O6S |
| Molecular Weight | 700.86 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCC[C@H](c2ccc(OC)c(OC)c2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cn1 |
| InChI | InChI=1S/C37H44N6O6S/c1-5-42-25-29(24-38-42)50(46,47)39-18-10-15-31(28-16-17-33(48-3)34(23-28)49-4)43-36(44)30-13-9-14-32(35(30)37(43)45)41-21-19-40(20-22-41)26(2)27-11-7-6-8-12-27/h6-9,11-14,16-17,23-26,31,39H,5,10,15,18-22H2,1-4H3/t26-,31-/m1/s1 |
| InChIKey | WPNRPROJDOXVQX-MXBOTTGLSA-N |
| XLogP | 4.90 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|