C19H22BrNO — CID 58946069
2-bromo-3-[(3R)-3-(phenylmethoxymethyl)hex-5-enyl]pyridine (PubChem CID 58946069) has the molecular formula C19H22BrNO and a molecular weight of 360.30 g/mol. Its IUPAC name is 2-bromo-3-[(3R)-3-(phenylmethoxymethyl)hex-5-enyl]pyridine.
| Compound Name | 2-bromo-3-[(3R)-3-(phenylmethoxymethyl)hex-5-enyl]pyridine |
|---|---|
| PubChem CID | 58946069 |
| Molecular Formula | C19H22BrNO |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-bromo-3-[(3R)-3-(phenylmethoxymethyl)hex-5-enyl]pyridine |
| SMILES | C=CC[C@@H](CCc1cccnc1Br)COCc1ccccc1 |
| InChI | InChI=1S/C19H22BrNO/c1-2-7-16(11-12-18-10-6-13-21-19(18)20)14-22-15-17-8-4-3-5-9-17/h2-6,8-10,13,16H,1,7,11-12,14-15H2/t16-/m0/s1 |
| InChIKey | VLXFCJDVCLVRTE-INIZCTEOSA-N |
| XLogP | 5.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|