amino 2,3-dimethyl-4-phenylhexanoate

C14H21NO2 — CID 58946320

IUPACamino 2,3-dimethyl-4-phenylhexanoate
SMILESCCC(c1ccccc1)C(C)C(C)C(=O)ON
InChIInChI=1S/C14H21NO2/c1-4-13(12-8-6-5-7-9-12)10(2)11(3)14(16)17-15/h5-11,13H,4,15H2,1-3H3
InChIKeyORUJUPAXFYNFNY-UHFFFAOYSA-N
MW235.33 g/mol
LogP2.87
Rot. Bonds5

About amino 2,3-dimethyl-4-phenylhexanoate

amino 2,3-dimethyl-4-phenylhexanoate (PubChem CID 58946320) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is amino 2,3-dimethyl-4-phenylhexanoate.

Molecular Properties

Compound Nameamino 2,3-dimethyl-4-phenylhexanoate
PubChem CID58946320
Molecular FormulaC14H21NO2
Molecular Weight235.33 g/mol
Exact Mass235.16
IUPAC Nameamino 2,3-dimethyl-4-phenylhexanoate
SMILESCCC(c1ccccc1)C(C)C(C)C(=O)ON
InChIInChI=1S/C14H21NO2/c1-4-13(12-8-6-5-7-9-12)10(2)11(3)14(16)17-15/h5-11,13H,4,15H2,1-3H3
InChIKeyORUJUPAXFYNFNY-UHFFFAOYSA-N
XLogP2.87
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.33
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2,3-dimethyl-4-phenylhexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2,3-dimethyl-4-phenylhexanoate?
The IUPAC name of amino 2,3-dimethyl-4-phenylhexanoate (CID 58946320) is amino 2,3-dimethyl-4-phenylhexanoate.
What is the SMILES notation for amino 2,3-dimethyl-4-phenylhexanoate?
The canonical SMILES for amino 2,3-dimethyl-4-phenylhexanoate is CCC(c1ccccc1)C(C)C(C)C(=O)ON.
What is the InChIKey of amino 2,3-dimethyl-4-phenylhexanoate?
The InChIKey is ORUJUPAXFYNFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-13(12-8-6-5-7-9-12)10(2)11(3)14(16)17-15/h5-11,13H,4,15H2,1-3H3.
What are the key properties of amino 2,3-dimethyl-4-phenylhexanoate?
amino 2,3-dimethyl-4-phenylhexanoate has a molecular weight of 235.33 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2,3-dimethyl-4-phenylhexanoate is sourced from PubChem (CID 58946320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).