C12H24O5Si4 — CID 58946359
2,4,6,8-tetramethyl-2-(2-phenoxyethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 58946359) has the molecular formula C12H24O5Si4 and a molecular weight of 360.66 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2-(2-phenoxyethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2-(2-phenoxyethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 58946359 |
| Molecular Formula | C12H24O5Si4 |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2,4,6,8-tetramethyl-2-(2-phenoxyethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCOc2ccccc2)O[SiH](C)O1 |
| InChI | InChI=1S/C12H24O5Si4/c1-18-14-19(2)16-21(4,17-20(3)15-18)11-10-13-12-8-6-5-7-9-12/h5-9,18-20H,10-11H2,1-4H3 |
| InChIKey | OJLGBSJEEZURBB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|