About (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol
(2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol (PubChem CID 58946411) has the molecular formula C6H8F2O3
and a molecular weight of 166.12 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol.
Molecular Properties
| Compound Name | (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol |
| PubChem CID | 58946411 |
| Molecular Formula | C6H8F2O3 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol |
| SMILES | C=C1O[C@H](CO)C(O)C1(F)F |
| InChI | InChI=1S/C6H8F2O3/c1-3-6(7,8)5(10)4(2-9)11-3/h4-5,9-10H,1-2H2/t4-,5?/m1/s1 |
| InChIKey | QXIJYBIKJSKDJK-CNZKWPKMSA-N |
| XLogP | -0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol?
The IUPAC name of (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol (CID 58946411) is (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol.
What is the SMILES notation for (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol?
The canonical SMILES for (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol is C=C1O[C@H](CO)C(O)C1(F)F.
What is the InChIKey of (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol?
The InChIKey is QXIJYBIKJSKDJK-CNZKWPKMSA-N. The full InChI is InChI=1S/C6H8F2O3/c1-3-6(7,8)5(10)4(2-9)11-3/h4-5,9-10H,1-2H2/t4-,5?/m1/s1.
What are the key properties of (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol?
(2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol has a molecular weight of 166.12 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-difluoro-2-(hydroxymethyl)-5-methylideneoxolan-3-ol is sourced from PubChem (CID 58946411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).