About CID 58946657
CID 58946657 (PubChem CID 58946657) has the molecular formula C6H15BCl3Si2
and a molecular weight of 260.53 g/mol.
Molecular Properties
| Compound Name | CID 58946657 |
| PubChem CID | 58946657 |
| Molecular Formula | C6H15BCl3Si2 |
| Molecular Weight | 260.53 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | — |
| SMILES | CC[Si]([B][Si](Cl)(Cl)Cl)(CC)CC |
| InChI | InChI=1S/C6H15BCl3Si2/c1-4-11(5-2,6-3)7-12(8,9)10/h4-6H2,1-3H3 |
| InChIKey | QNQHHFALSUMBLQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 58946657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58946657?
The IUPAC name of CID 58946657 (CID 58946657) is not available.
What is the SMILES notation for CID 58946657?
The canonical SMILES for CID 58946657 is CC[Si]([B][Si](Cl)(Cl)Cl)(CC)CC.
What is the InChIKey of CID 58946657?
The InChIKey is QNQHHFALSUMBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BCl3Si2/c1-4-11(5-2,6-3)7-12(8,9)10/h4-6H2,1-3H3.
What are the key properties of CID 58946657?
CID 58946657 has a molecular weight of 260.53 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58946657 is sourced from PubChem (CID 58946657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).