C14H20N2O2 — CID 589469
3-hydroxy-2,2,4,4-tetramethyl-5-(4-methylphenyl)-1-oxidoimidazol-1-ium (PubChem CID 589469) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-hydroxy-2,2,4,4-tetramethyl-5-(4-methylphenyl)-1-oxidoimidazol-1-ium.
| Compound Name | 3-hydroxy-2,2,4,4-tetramethyl-5-(4-methylphenyl)-1-oxidoimidazol-1-ium |
|---|---|
| PubChem CID | 589469 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-hydroxy-2,2,4,4-tetramethyl-5-(4-methylphenyl)-1-oxidoimidazol-1-ium |
| SMILES | Cc1ccc(C2=[N+]([O-])C(C)(C)N(O)C2(C)C)cc1 |
| InChI | InChI=1S/C14H20N2O2/c1-10-6-8-11(9-7-10)12-13(2,3)16(18)14(4,5)15(12)17/h6-9,18H,1-5H3 |
| InChIKey | NATHZAUAVBEFNC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|