C12H14N2 — CID 58947005
4-methylidene-3,5,6,7,8,9-hexahydroindeno[2,1-d]pyrimidine (PubChem CID 58947005) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-methylidene-3,5,6,7,8,9-hexahydroindeno[2,1-d]pyrimidine.
| Compound Name | 4-methylidene-3,5,6,7,8,9-hexahydroindeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 58947005 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-methylidene-3,5,6,7,8,9-hexahydroindeno[2,1-d]pyrimidine |
| SMILES | C=C1NC=NC2=C1C1=C(CCCC1)C2 |
| InChI | InChI=1S/C12H14N2/c1-8-12-10-5-3-2-4-9(10)6-11(12)14-7-13-8/h7H,1-6H2,(H,13,14) |
| InChIKey | HGAIBYKTBLORDD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |