C20H20IrN10-2 — CID 58947273
iridium;4-methyl-3-phenyl-1,2,4-triazole;5-(3H-pyrazol-3-id-2-yl)-1-(1,4,5-trimethylimidazol-2-yl)-1,2,4-triazole (PubChem CID 58947273) has the molecular formula C20H20IrN10-2 and a molecular weight of 592.67 g/mol. Its IUPAC name is iridium;4-methyl-3-phenyl-1,2,4-triazole;5-(3H-pyrazol-3-id-2-yl)-1-(1,4,5-trimethylimidazol-2-yl)-1,2,4-triazole.
| Compound Name | iridium;4-methyl-3-phenyl-1,2,4-triazole;5-(3H-pyrazol-3-id-2-yl)-1-(1,4,5-trimethylimidazol-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 58947273 |
| Molecular Formula | C20H20IrN10-2 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | iridium;4-methyl-3-phenyl-1,2,4-triazole;5-(3H-pyrazol-3-id-2-yl)-1-(1,4,5-trimethylimidazol-2-yl)-1,2,4-triazole |
| SMILES | Cc1nc(-n2ncnc2-n2[c-]ccn2)n(C)c1C.Cn1cnnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C11H12N7.C9H8N3.Ir/c1-8-9(2)16(3)11(15-8)18-10(12-7-14-18)17-6-4-5-13-17;1-12-7-10-11-9(12)8-5-3-2-4-6-8;/h4-5,7H,1-3H3;2-5,7H,1H3;/q2*-1; |
| InChIKey | WYHCXPUPTJMUQP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 97.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|