About 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium
2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium (PubChem CID 58947574) has the molecular formula C24H19IrN2O-
and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium.
Molecular Properties
| Compound Name | 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium |
| PubChem CID | 58947574 |
| Molecular Formula | C24H19IrN2O- |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium |
| SMILES | Cc1cccc(-c2ccccc2)c1-n1ccnc1-c1[c-]cc2c(c1)CCO2.[Ir] |
| InChI | InChI=1S/C24H19N2O.Ir/c1-17-6-5-9-21(18-7-3-2-4-8-18)23(17)26-14-13-25-24(26)20-10-11-22-19(16-20)12-15-27-22;/h2-9,11,13-14,16H,12,15H2,1H3;/q-1; |
| InChIKey | NXGMRLDFLZMCGQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium?
The IUPAC name of 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium (CID 58947574) is 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium.
What is the SMILES notation for 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium?
The canonical SMILES for 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium is Cc1cccc(-c2ccccc2)c1-n1ccnc1-c1[c-]cc2c(c1)CCO2.[Ir].
What is the InChIKey of 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium?
The InChIKey is NXGMRLDFLZMCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N2O.Ir/c1-17-6-5-9-21(18-7-3-2-4-8-18)23(17)26-14-13-25-24(26)20-10-11-22-19(16-20)12-15-27-22;/h2-9,11,13-14,16H,12,15H2,1H3;/q-1;.
What are the key properties of 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium?
2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium has a molecular weight of 543.65 g/mol, XLogP of 5.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydro-2H-1-benzofuran-6-id-5-yl)-1-(2-methyl-6-phenylphenyl)imidazole;iridium is sourced from PubChem (CID 58947574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).