C17H14F6O8S2 — CID 58947797
5-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]-2-methoxybenzenesulfonic acid (PubChem CID 58947797) has the molecular formula C17H14F6O8S2 and a molecular weight of 524.41 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58947797 |
| Molecular Formula | C17H14F6O8S2 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(OC)c(S(=O)(=O)O)c2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H14F6O8S2/c1-30-11-5-3-9(7-13(11)32(24,25)26)15(16(18,19)20,17(21,22)23)10-4-6-12(31-2)14(8-10)33(27,28)29/h3-8H,1-2H3,(H,24,25,26)(H,27,28,29) |
| InChIKey | ARZMUWFRZWDMNL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|