C8H8F8O3 — CID 58947848
1-[difluoro(methoxy)methoxy]-1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 58947848) has the molecular formula C8H8F8O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is 1-[difluoro(methoxy)methoxy]-1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1-[difluoro(methoxy)methoxy]-1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 58947848 |
| Molecular Formula | C8H8F8O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-[difluoro(methoxy)methoxy]-1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(C)(F)C(F)(F)OC(F)(F)OC |
| InChI | InChI=1S/C8H8F8O3/c1-4(9)6(11,12)18-5(2,10)7(13,14)19-8(15,16)17-3/h1H2,2-3H3 |
| InChIKey | BKORYNCDJYSRBH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|