C9H20N2O2S — CID 58947953
1-(1-aminocyclohexyl)-N,N-dimethylmethanesulfonamide (PubChem CID 58947953) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(1-aminocyclohexyl)-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-(1-aminocyclohexyl)-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 58947953 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(1-aminocyclohexyl)-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CC1(N)CCCCC1 |
| InChI | InChI=1S/C9H20N2O2S/c1-11(2)14(12,13)8-9(10)6-4-3-5-7-9/h3-8,10H2,1-2H3 |
| InChIKey | VRAYCVCGWLFZOC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |